Compound Description
| ID: C0005 | Common name: Delphinidin Chloride |
| IUPAC: 2-(3,4,5-trihydroxyphenyl)chromenylium-3,5,7-triol;chloride | CAS: NA |
| Chembl ID: CHEMBL590878 | Pubchem ID: CID:68245 |
| Formula: C15H10O7.ClH | TCM-ID: TCMC1005 |
| Smiles: C1=C(C=C(C(=C1O)O)O)C2=[O+]C3=CC(=CC(=C3C=C2O)O)O.[Cl-] | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T01JSX | Carbonyl reductase [NADPH] 1 | CBR1 |
P16152 |
A | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T09KQF | Proliferating cell nuclear antigen | PCNA |
P12004 |
B | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 1 Reference(s) |
| T26KIE | Transcription factor AP-1 | JUN |
P05412 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1240 | Huang Jing Zi | 黄荆子 | NA | Vitex negundo |
Ckey description of the interaction between compound and target