Compound Description
| ID: C0038 | Common name: Eckol |
| IUPAC: 4-(3,5-dihydroxyphenoxy)dibenzo-p-dioxin-1,3,6,8-tetrol | CAS: CAS:88798-74-7 |
| Chembl ID: CHEMBL471187 | Pubchem ID: CID:145937 |
| Formula: C18H12O9 | TCM-ID: TCMC1096 |
| Smiles: C1=C(C=C(C=C1O)OC2=C(C=C(C3=C2OC4=C(C=C(C=C4O3)O)O)O)O)O | |
| Alias:
4-(3,5-Dihydroxyphenoxy)dibenzo[b,e][1,4]dioxin-1,3,6,8-tetrol;
4-(3,5-Dihydroxyphenoxy)dibenzo[b,e][1,4]dioxine-1,3,6,8-tetraol; Eckol |
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T21DZX | Amine oxidase [flavin-containing] A | MAOA |
P21397 |
A | 1 Reference(s) |
| T14VZR | AKT-interacting protein | AKTIP |
Q9H8T0 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
B | 1 Reference(s) |
| T80OJF | Interstitial collagenase | MMP1 |
P03956 |
B | 1 Reference(s) |
| T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0117 | Kun Bu | 昆布 | Kelp thallus | Laminaria japonica |
Ckey description of the interaction between compound and target