Compound Description
| ID: C0103 | Common name: Geranylgeraniol |
| IUPAC: (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol | CAS: CAS:24034-73-9 |
| Chembl ID: CHEMBL478589 | Pubchem ID: CID:5281365 |
| Formula: C20H34O | TCM-ID: TCMC1240 |
| Smiles: OC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)\C | |
| Alias:
2,6,10,14-Hexadecatetraen-1-ol, 3,7,11,15-tetramethyl-, (E,E,E)-;
(2E,6E,10E)-3,7,11,15-Tetramethyl-2,6,10,14-hexadecatetraen-1-ol; (E,E,E)-Geranylgeraniol; (E,E,E)-Geranylgeranyl alcohol; All-trans-Geranylgeraniol; Geranylgeraniol; Geranylgeranyl alcohol; trans,trans,trans-Geranylgeraniol; trans-Geranylgeraniol |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
B | 1 Reference(s) |
| T07LHA | UbiA prenyltransferase domain-containing protein 1 | UBIAD1 |
Q9Y5Z9 |
B | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0697 | Ya Ma Zi | 亚麻子 | Common flax seed | Linum usitatissimum |
Ckey description of the interaction between compound and target