ID: C0132 | Common name: Hyperforin |
IUPAC: (1R,5R,6R,7S)-2-hydroxy-6-methyl-1,3,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)-5-(2-methylpropanoyl)bicyclo[3.3.1]non-2-ene-4,9-dione | CAS: CAS:11079-53-1 |
Chembl ID: CHEMBL1237210 | Pubchem ID: CID:441298 |
Formula: C35H52O4 | TCM-ID: TCMC1355 |
Smiles: CC(C)C(=O)C12C(=O)C(=C(C(C1=O)(CC(C2(C)CCC=C(C)C)CC=C(C)C)CC=C(C)C)O)CC=C(C)C | |
Alias:
Bicyclo[3.3.1]non-3-ene-2,9-dione, 4-hydroxy-6-methyl-1,3,7-tris(3-methyl-2-butenyl)-5-(2-methyl-1-oxopropyl)-6-(4-methyl-3-pentenyl)-, (1R,5S,6R,7S)-;
Bicyclo[3.3.1]non-3-ene-2,9-dione, 4-hydroxy-6-methyl-1,3,7-tris(3-methyl-2-butenyl)-5-(2-methyl-1-oxopropyl)-6-(4-methyl-3-pentenyl)-, [1R-(6-endo,7-exo)]-; (1R,5S,6R,7S)-4-Hydroxy-6-methyl-1,3,7-tris(3-methyl-2-buten-1-yl)-5-(2-methyl-1-oxopropyl)-6-(4-methyl-3-penten-1-yl)bicyclo[3.3.1]non-3-ene-2,9-dione; (+)-Hyperforin; Bicyclo[3.3.1]non-3-ene-2,9-dione, 4-hydroxy-6-methyl-1,3,7-tris(3-methyl-2-butenyl)-S-(2-methyl-1-oxopropyl)-6-(4-methyl-3-pentenyl)-, [1R-(1α,5α,6β,7α)]-; Hyperforin |
Structure: |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
A | 1 Reference(s) |
T32TBL | Short transient receptor potential channel 6 | TRPC6 |
Q9Y210 |
A | 2 Reference(s) |
T67HAF | Signal transducer and activator of transcription 1-alpha/beta | STAT1 |
P42224 |
A | 2 Reference(s) |
T54CIF | Interleukin-8 | CXCL8 |
P10145 |
B | 1 Reference(s) |
T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
B | 1 Reference(s) |
T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
---|---|---|---|---|
H0181 | Luo Bu Ma | 罗布麻 | Dogbane | Apocynum venetum |