Compound Description
| ID: C0171 | Common name: Kynurenine |
| IUPAC: 2-amino-4-(2-aminophenyl)-4-oxobutanoic acid | CAS: CAS:2922-83-0 |
| Chembl ID: CHEMBL1377927 | Pubchem ID: CID:846 |
| Formula: C10H12N2O3 | TCM-ID: TCMC1454 |
| Smiles: OC(=O)C(CC(=O)c1ccccc1N)N | |
| Alias:
Alanine, 3-anthraniloyl-, L-;
Benzenebutanoic acid, α,2-diamino-γ-oxo-, (S)-; (αS)-α,2-Diamino-γ-oxobenzenebutanoic acid; (2S)-4-(2-Aminophenyl)-2-azaniumyl-4-oxobutanoate; 3-Anthraniloylalanine; Kynurenin; Kynurenine; L-3-(o-Aminobenzoyl)alanine; L-Kynurenine |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
B | 1 Reference(s) |
| T14LSK | E3 ubiquitin-protein ligase XIAP | XIAP |
P98170 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T14JSQ | Baculoviral IAP repeat-containing protein 2 | BIRC2 |
Q13490 |
C | 1 Reference(s) |
| T70YKV | Baculoviral IAP repeat-containing protein 3 | BIRC3 |
Q13489 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 5)
Ckey description of the interaction between compound and target