Compound Description
| ID: C0220 | Common name: Methylprednisolone |
| IUPAC: (6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one | CAS: CAS:83-43-2 |
| Chembl ID: CHEMBL650 | Pubchem ID: CID:6741 |
| Formula: C22H30O5 | TCM-ID: TCMC1583 |
| Smiles: OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)C | |
| Alias:
Pregna-1,4-diene-3,20-dione, 11β,17,21-trihydroxy-6α-methyl-;
(6α,11β)-11,17,21-Trihydroxy-6-methylpregna-1,4-diene-3,20-dione; 11β,17,21-Trihydroxy-6α-methylpregna-1,4-diene-3,20-dione; 11β,17α,21-Trihydroxy-6α-methyl-1,4-pregnadiene-3,20-dione; 6α-Methyl-11β,17α,21β-trihydroxy-1,4-pregnadiene-3,20-dione; 6α-Methylprednisolone; A-Methapred; Besonia; Dopomedrol; Duralone; M-Prednisol; Medesone; Medorol; Medralone; Medrate; Medrol; Medrone; Metastab; Methylprednisolone; Methypred; Metilbetasone; Metilprednisolone; Metipred; Metrisone; Moderin; NSC 19987; Noretona; Prednol; Prednol L; Promacortine; SW 196788; Solimedrol; Suprametil; U 7532; Urbason; Urbasone; Urbazone; Wyacort; Δ1-6α-Methylhydrocortisone |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T07NML | P-selectin | SELP |
P16109 |
C | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 2 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0181 | Luo Bu Ma | 罗布麻 | Dogbane | Apocynum venetum |
Ckey description of the interaction between compound and target