| ID: C0239 | Common name: Nandrolone Decanoate |
| IUPAC: [(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] decanoate | CAS: CAS:360-70-3 |
| Chembl ID: CHEMBL1200946 | Pubchem ID: CID:9677 |
| Formula: C28H44O3 | TCM-ID: TCMC1727 |
| Smiles: CCCCCCCCCC(=O)O[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12 | |
| Alias:
Estr-4-en-3-one, 17β-hydroxy-, decanoate;
(17β)-17-[(1-Oxodecyl)oxy]estr-4-en-3-one; Decanoic acid, ester with 17β-hydroxyestr-4-en-3-one; 17β-Hydroxy-19-norandrost-4-en-3-one 17-decanoate; 17β-Hydroxyestr-4-en-3-one 17-decanoate; 17β-Hydroxyestr-4-en-3-one decanoate; 17β-Nandrolone laureate; 17β-Nortestosterone laureate; 19-Nor-17β-hydroxy-3-ketoandrost-4-ene 17-decanoate; 19-Norandrostenolone decanoate; 19-Nortestosterone 17β-decanoate; 19-Nortestosterone decanoate; Anabolicum; Anabolin Forte; DECA-Deca-Durabolin; Deca-Durabol; Deca-Durabolin; Deca-Hybolin; Decanofort; Extraboline; Hybolin decanoate; Nandrobolic LA; Nandrolone decanoate; Norandrostenolone decanoate; Nortestosterone decanoate; Retabolil |
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T53YWQ | Pro-neuropeptide Y [Cleaved into: Neuropeptide Y | NPY |
P01303 |
C | 1 Reference(s) |