Compound Description
| ID: C0265 | Common name: Oleuropein |
| IUPAC: methyl (4S,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate | CAS: CAS:32619-42-4 |
| Chembl ID: CHEMBL1911053 | Pubchem ID: CID:5281544 |
| Formula: C25H32O13 | TCM-ID: TCMC1790 |
| Smiles: OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@H](/C/2=C\C)CC(=O)OCCc2ccc(c(c2)O)O)C(=O)OC)[C@@H]([C@H]([C@@H]1O)O)O | |
| Alias:
2H-Pyran-4-acetic acid, 3-ethylidene-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-, 2-(3,4-dihydroxyphenyl)ethyl ester, [2S-(2α,3E,4β)]-;
2H-Pyran-4-acetic acid, 5-carboxy-3-ethylidene-2-(β-D-glucosyloxy)-3,4-dihydro-, 3,4-dihydroxyphenethyl 5-methyl ester; Oleuropein; Oleoeuropein; Oleoeuropeine; Oleuropeine; Opiace |
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
B | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
| T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0187 | Bao Ma Zi Pi | 暴马子皮 | bark of manchurian lilac | Syringa reticulata |
Ckey description of the interaction between compound and target