Compound Description
| ID: C0336 | Common name: Pterostilbene |
| IUPAC: 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol | CAS: CAS:537-42-8 |
| Chembl ID: CHEMBL83527 | Pubchem ID: CID:5281727 |
| Formula: C16H16O3 | TCM-ID: TCMC1964 |
| Smiles: COc1cc(/C=C/c2ccc(cc2)O)cc(c1)OC | |
| Alias:
4-Stilbenol, 3',5'-dimethoxy-, (E)-;
Phenol, 4-[2-(3,5-dimethoxyphenyl)ethenyl]-, (E)-; 4-[(1E)-2-(3,5-Dimethoxyphenyl)ethenyl]phenol; (E)-2-(3,5-Dimethoxyphenyl)-1-(4-hydroxyphenyl)ethene; (E)-4-(3,5-Dimethoxystyryl)phenol; (E)-4-Hydroxy-3',5'-dimethoxystilbene; 3,5-Dimethoxy-4'-hydroxy-trans-stilbene; E-Pterostilbene; Pterostilbene; trans-3,5-Dimethoxy-4'-hydroxystilbene; trans-Pterostilbene |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 2 Reference(s) |
| T63C6D | Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic | GPD1 |
P21695 |
A | 1 Reference(s) |
| T93SFQ | NAD-dependent protein deacetylase sirtuin-1 | SIRT1 |
Q96EB6 |
B | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
C | 3 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target