Compound Description
| ID: C0351 | Common name: Quercetagetin |
| IUPAC: 2-(3,4-dihydroxyphenyl)-3,5,6,7-tetrahydroxychromen-4-one | CAS: CAS:90-18-6 |
| Chembl ID: CHEMBL413552 | Pubchem ID: CID:5281680 |
| Formula: C15H10O8 | TCM-ID: TCMC1981 |
| Smiles: C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C(=C3O)O)O)O)O)O | |
| Alias:
Flavone, 3,3',4',5,6,7-hexahydroxy-;
Quercetagetin; 2-(3,4-Dihydroxyphenyl)-3,5,6,7-tetrahydroxy-4H-1-benzopyran-4-one; 3,3',4',5,6,7-Hexahydroxyflavone; 3,5,6,7,3',4'-Hexahydroxyflavone; 6-Hydroxyquercetin; NSC 115916 |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T37BP1 | Serine/threonine-protein kinase pim-1 | PIM1 |
P11309 |
A | 2 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
A | 2 Reference(s) |
| T01E7W | Aurora kinase B | AURKB |
Q96GD4 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target