Compound Description
| ID: C0361 | Common name: (-)-Antofine |
| IUPAC: (13aR)-2,3,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine | CAS: CAS:32671-82-2 |
| Chembl ID: CHEMBL228286 | Pubchem ID: CID:639288 |
| Formula: C23H25NO3 | TCM-ID: TCMC2 |
| Smiles: COc1ccc2c(c1)c1cc(OC)c(cc1c1c2CN2CCC[C@@H]2C1)OC | |
| Alias:
Antofine;
Dibenzo[f,h]pyrrolo[1,2-b]isoquinoline, 9,11,12,13,13a,14-hexahydro-2,3,6-trimethoxy-, (R)-; (13aR)-9,11,12,13,13a,14-Hexahydro-2,3,6-trimethoxydibenzo[f,h]pyrrolo[1,2-b]isoquinoline; (-)-13aα-Antofine; (-)-Antofine; (R)-(-)-Antofine; 7-Demethoxytylophorine; Alkaloid A, from Cynanchum vincetoxicum |
Structure:
|
Related Targets (Total: 1)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T05WU9 | Serine/threonine-protein phosphatase 2A activator | PTPA |
Q15257 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0684 | Xu Chang Qing | 徐长卿 | Paniculate swallowwort | Cynanchum paniculatum |
Ckey description of the interaction between compound and target