Compound Description
| ID: C0411 | Common name: Somatostatin |
| IUPAC: NA | CAS: NA |
| Chembl ID: CHEMBL1823872 | Pubchem ID: CID:16129706 |
| Formula: C76H104N18O19S2 | TCM-ID: TCMC2092 |
| Smiles: NCCCC[C@@H]1N=C(O)[C@H](CSSC[C@H](N=C(O)[C@H](CO)N=C(O)[C@@H](N=C(O)[C@H](Cc2ccccc2)N=C([C@@H](N=C([C@@H](N=C([C@@H](N=C([C@@H](N=C([C@@H](N=C([C@@H](N=C1O)CC(=N)O)O)Cc1ccccc1)O)Cc1ccccc1)O)Cc1c[nH]c2c1cccc2)O)CCCCN)O)[C@H](O)C)O)[C@H](O)C)C(=O)O)N=C(CN=C([C@@H](N)C)O)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T06MXL | Neprilysin | MME |
P08473 |
A | 1 Reference(s) |
| T86YQL | Prolactin | PRL |
P01236 |
A | 1 Reference(s) |
| T38ILG | Zinc finger protein PLAGL1 | PLAGL1 |
Q9UM63 |
C | 1 Reference(s) |
| T80ZEX | Sodium/hydrogen exchanger 8 | SLC9A8 |
Q9Y2E8 |
C | 2 Reference(s) |
| T24VFB | Somatotropin | GH1 |
P01241 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T43IF3 | Chromogranin-A | CHGA |
P10645 |
C | 1 Reference(s) |
| T02DKV | Gastrin [Cleaved into: Gastrin-71 | GAST |
P01350 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target