Compound Description
| ID: C0525 | Common name: Grandisin |
| IUPAC: (2R,3R,4R,5R)-3,4-dimethyl-2,5-bis(3,4,5-trimethoxyphenyl)oxolane | CAS: CAS:53250-50-3 |
| Chembl ID: CHEMBL459404 | Pubchem ID: CID:10048436 |
| Formula: C24H32O7 | TCM-ID: TCMC2499 |
| Smiles: COc1cc(cc(c1OC)OC)[C@@H]1O[C@H]([C@@H]([C@H]1C)C)c1cc(OC)c(c(c1)OC)OC | |
| Alias:
Furan, tetrahydro-3,4-dimethyl-2,5-bis(3,4,5-trimethoxyphenyl)-, (2α,3β,4α,5β)-(-)-;
rel-(-)-(2R,3R,4R,5R)-Tetrahydro-3,4-dimethyl-2,5-bis(3,4,5-trimethoxyphenyl)furan; (-)-Grandisin; Grandisin |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T69RXK | Cytochrome P450 2C9 | CYP2C9 |
P11712 |
A | 1 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
A | 1 Reference(s) |
| T16QQC | Cytochrome P450 3A5 | CYP3A5 |
P20815 |
A | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0180 | Lu Zhu Gen | 芦竹根 | Giantreed rhizome | Arundo donax |
Ckey description of the interaction between compound and target