Compound Description
| ID: C0631 | Common name: 2,6-Diacetyl-7,9-Dihydroxy-8,9B-Dimethyldibenzofuran-1,3-Dione |
| IUPAC: 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione | CAS: CAS:125-46-2 |
| Chembl ID: CHEMBL1375951 | Pubchem ID: CID:5646 |
| Formula: C18H16O7 | TCM-ID: TCMC335 |
| Smiles: CC1=C(C(=C2C(=C1O)C3(C(=CC(=O)C(C3=O)C(=O)C)O2)C)C(=O)C)O | |
| Alias:
Usnic acid;
2,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyl-1,3(2H,9bH)-dibenzofurandione; (±)-Usnic acid; 2,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzo[b,d]furan-1,3(2H,9bH)-dione; 2,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione; NSC 8517; Usnein; Usniacin; Usno |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T49BJB | 4-hydroxyphenylpyruvate dioxygenase | HPD |
P32754 |
A | 1 Reference(s) |
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
A | 1 Reference(s) |
| T73LPO | Poly [ADP-ribose] polymerase 1 | PARP1 |
P09874 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1133 | Gui Jian Yu | 鬼箭羽 | Winged euonymus | Euonymus alatus |
Ckey description of the interaction between compound and target