Compound Description
| ID: C0672 | Common name: Saikosaponin A |
| IUPAC: (2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5S,6R)-3,5-dihydroxy-2-[[(1S,2S,4S,5R,8R,9R,10S,13S,14R,17S,18R)-2-hydroxy-9-(hydroxymethyl)-4,5,9,13,20,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-yl]oxy]-6-methyloxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | CAS: CAS:20736-09-8 |
| Chembl ID: CHEMBL3542194 | Pubchem ID: CID:167928 |
| Formula: C42H68O13 | TCM-ID: TCMC3631 |
| Smiles: CC1C(C(C(C(O1)OC2CCC3(C(C2(C)CO)CCC4(C3C=CC56C4(CC(C7(C5CC(CC7)(C)C)CO6)O)C)C)C)O)OC8C(C(C(C(O8)CO)O)O)O)O | |
| Alias:
Saikosaponin A;
(3β,4α,16β)-13,28-Epoxy-16,23-dihydroxyolean-11-en-3-yl 6-deoxy-3-O-β-D-glucopyranosyl-β-D-galactopyranoside; Oleanane, β-D-galactopyranoside deriv.; Salikosaponin A |
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 1 Reference(s) |
| T54VQA | Cyclin-dependent kinase inhibitor 2A | CDKN2A |
P42771 |
B | 1 Reference(s) |
| T41TXS | Retinoblastoma-associated protein | RB1 |
P06400 |
C | 1 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T12CVR | Cyclin-dependent kinase 4 inhibitor B (Multiple tumor suppressor 2) (MTS-2) (p14-INK4b) (p15-INK4b) (p15INK4B) | CDKN2B |
P42772 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0650 | Chai Hu | 柴胡 | Chinese thorowax | Bupleurum chinense |
Ckey description of the interaction between compound and target