Compound Description
| ID: C0689 | Common name: Cytochrome C |
| IUPAC: 3-[7,12-bis[1-[2-amino-3-(methylamino)-3-oxopropyl]sulfanylethyl]-18-(2-carboxyethyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:439171 |
| Formula: C42H52FeN8O6S2 | TCM-ID: TCMC3801 |
| Smiles: CNC(=O)C(CSC(C1=C(C)C2=Cc3[n-]c(c(c3C(SCC(C(=O)NC)[NH3+])C)C)C=C3N=C(C=c4[n-]c(=CC1=N2)c(C)c4CCC(=O)[O-])C(=C3C)CCC(=O)[O-])C)[NH3+].[Fe+2] | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 3 Reference(s) |
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 |
Q96P20 |
B | 1 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T82O9S | Protein Mpv17 | MPV17 |
P39210 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0215 | Mai Ya | 麦芽 | Barley germinating fruit | Hordeum vulgare |
Ckey description of the interaction between compound and target