Compound Description
| ID: C0722 | Common name: Aurapten |
| IUPAC: 7-[(2Z)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one | CAS: CAS:495-02-3 |
| Chembl ID: NA | Pubchem ID: CID:1795390 |
| Formula: C19H22O3 | TCM-ID: TCMC4182 |
| Smiles: C/C(=C/COc1ccc2c(c1)oc(=O)cc2)/CCC=C(C)C | |
| Alias:
2H-1-Benzopyran-2-one, 7-[(3,7-dimethyl-2,6-octadienyl)oxy]-, (E)-;
2H-1-Benzopyran-2-one, 7-[[(2E)-3,7-dimethyl-2,6-octadienyl]oxy]-; Coumarin, 7-(geranyloxy)-; Coumarin, 7-[(3,7-dimethyl-2,6-octadienyl)oxy]-, (E)-; 7-[[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]oxy]-2H-1-benzopyran-2-one; (E)-7-Geranoxycoumarin; 7-Geranyloxycoumarin; Aurapten; Aurapten (C19H22O3); Auraptene; Rapten |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T03NWF | Sterol O-acyltransferase 1 | SOAT1 |
P35610 |
A | 1 Reference(s) |
| T01QLH | Estrogen receptor | ESR1 |
P03372 |
B | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0813 | Zhi Shi | 枳实 | Seville orange young fruit | Citrus aurantium |
Ckey description of the interaction between compound and target