Compound Description
| ID: C0732 | Common name: 3(S)-3-Butyl-4,5-Dihydrophthalide |
| IUPAC: (3S)-3-butyl-4,5-dihydro-3H-2-benzofuran-1-one | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:3085257 |
| Formula: C12H16O2 | TCM-ID: TCMC4259 |
| Smiles: CCCCC1C2=C(C=CCC2)C(=O)O1 | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 2)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target