Compound Description
| ID: C0741 | Common name: Α-Crocetin |
| IUPAC: (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedioic acid | CAS: CAS:27876-94-4 |
| Chembl ID: CHEMBL464792 | Pubchem ID: CID:5281232 |
| Formula: C20H24O4 | TCM-ID: TCMC4309 |
| Smiles: CC(=CC=CC=C(C)C=CC=C(C)C(=O)O)C=CC=C(C)C(=O)O | |
| Alias:
2,4,6,8,10,12,14-Hexadecaheptaenedioic acid, 2,6,11,15-tetramethyl-, (all-E)-;
8,8'-Diapo-ψ,ψ-carotenedioic acid; Crocetin; (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-Tetramethyl-2,4,6,8,10,12,14-hexadecaheptaenedioic acid; Apocarotenic acid; Crobit P; Crocetin (stable); NSC 407300; Stable crocetin; Transcrocetin; trans-Crocetin; α-Crocetin |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
A | 1 Reference(s) |
| T13KGH | Tyrosinase | TYR |
P14679 |
A | 1 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 1 Reference(s) |
| T63VZZ | Metastasis-suppressor KiSS-1 | KISS1 |
Q15726 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0818 | Zhi Zi | 栀子 | Cape jasmine fruit | Gardenia jasminoides |
Ckey description of the interaction between compound and target