| ID: C0747 | Common name: Cucurbitacin E |
| IUPAC: [(E,6R)-6-[(8S,9R,10R,13R,14S,16R,17R)-2,16-dihydroxy-4,4,9,13,14-pentamethyl-3,11-dioxo-8,10,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-2-methyl-5-oxohept-3-en-2-yl] acetate | CAS: CAS:18444-66-1 |
| Chembl ID: CHEMBL455056 | Pubchem ID: CID:5281319 |
| Formula: C32H44O8 | TCM-ID: TCMC4321 |
| Smiles: CC(=O)OC(/C=C/C(=O)[C@@]([C@H]1[C@H](O)C[C@@]2([C@]1(C)CC(=O)[C@@]1([C@H]2CC=C2[C@H]1C=C(O)C(=O)C2(C)C)C)C)(O)C)(C)C | |
| Alias:
19-Nor-9β,10α-lanosta-1,5,23-triene-3,11,22-trione, 2,16α,20,25-tetrahydroxy-9-methyl-, 25-acetate;
(9β,10α,16α,23E)-25-(Acetyloxy)-2,16,20-trihydroxy-9-methyl-19-norlanosta-1,5,23-triene-3,11,22-trione; Cucurbitacin E; Cucurbitacine E; NSC 106399; NSC 521775; α-Elaterin; α-Elaterine |
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T67X1L | Eukaryotic translation initiation factor 2 subunit 1 | EIF2S1 |
P05198 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0564 | Tu Bei Mu | 土贝母 | Paniculate bolbostemma | Rhizoma bolbostemmae |