Compound Description
| ID: C0754 | Common name: Orientin |
| IUPAC: 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one | CAS: CAS:28608-75-5 |
| Chembl ID: CHEMBL520866 | Pubchem ID: CID:5281675 |
| Formula: C21H20O11 | TCM-ID: TCMC4356 |
| Smiles: C1=CC(=C(C=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4C(C(C(C(O4)CO)O)O)O)O)O | |
| Alias:
Orientin;
2-(3,4-Dihydroxyphenyl)-8-β-D-glucopyranosyl-5,7-dihydroxy-4H-1-benzopyran-4-one; 8-β-D-Glucopyranosyl-3',4',5,7-tetrahydroxyflavone; Luteolin 8-C-glucoside; Luteolin 8-C-β-D-glucopyranoside; Luteolin 8-C-β-glucopyranoside; Luteolin-8-glucoside; Lutexin; Orientin (flavone) |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T24CXU | CCAAT/enhancer-binding protein delta | CEBPD |
P49716 |
C | 2 Reference(s) |
| T40LTN | Phospholipase A2, membrane associated | PLA2G2A |
P14555 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0628 | Xi Xian Cao | 豨莶草 | NA | Siegesbeckiae herba |
Ckey description of the interaction between compound and target