Compound Description
| ID: C0776 | Common name: Atractylenolide I |
| IUPAC: (4aS,8aS)-3,8a-dimethyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one | CAS: CAS:73069-13-3 |
| Chembl ID: CHEMBL449520 | Pubchem ID: CID:5321018 |
| Formula: C15H18O2 | TCM-ID: TCMC4851 |
| Smiles: CC1=C2CC3C(=C)CCCC3(C=C2OC1=O)C | |
| Alias:
Naphtho[2,3-b]furan-2(4H)-one, 4a,5,6,7,8,8a-hexahydro-3,8a-dimethyl-5-methylene-, (4aS-trans)-;
(4aS,8aS)-4a,5,6,7,8,8a-Hexahydro-3,8a-dimethyl-5-methylenenaphtho[2,3-b]furan-2(4H)-one; Atractylenolide I |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
A | 1 Reference(s) |
| T56TXY | Polyunsaturated fatty acid 5-lipoxygenase | ALOX5 |
P09917 |
A | 1 Reference(s) |
| T84XW5 | Placenta growth factor | PGF |
P49763 |
A | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
A | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0104 | Bai Zhu | 白术 | Largehead atractylodes | Atractylodes macrocephala |
Ckey description of the interaction between compound and target