Compound Description
| ID: C0790 | Common name: Pachymic Acid |
| IUPAC: (2R)-2-[(3S,5R,10S,13R,14R,16R,17R)-3-acetyloxy-16-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid | CAS: CAS:29070-92-6 |
| Chembl ID: CHEMBL468034 | Pubchem ID: CID:5484385 |
| Formula: C33H52O5 | TCM-ID: TCMC5004 |
| Smiles: CC(C)C(=C)CCC(C1C(CC2(C1(CCC3=C2CCC4C3(CCC(C4(C)C)OC(=O)C)C)C)C)O)C(=O)O | |
| Alias:
Eburica-8,24(28)-dien-21-oic acid, 3β,16α-dihydroxy-, 3-acetate;
Lanost-8-en-21-oic acid, 3β,16α-dihydroxy-24-methylene-, 3-acetate; (3β,16α)-3-(Acetyloxy)-16-hydroxy-24-methylenelanost-8-en-21-oic acid; 3-O-Acetyltumulosic acid; NSC 244427; Pachymic acid |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T23P74 | Caspase-9 | CASP9 |
P55211 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 1 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T90ORW | Bcl2-associated agonist of cell death | BAD |
Q92934 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1053 | Fu Ling | 茯苓 | Indian bread | Wolfiporia cocos |
Ckey description of the interaction between compound and target