Compound Description
| ID: C0826 | Common name: Limonin |
| IUPAC: [4-(1-acetyloxypropyl)-6-butanoyl-8,8-dimethyl-2-oxopyrano[2,3-h]chromen-5-yl] acetate | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:11762232 |
| Formula: C25H28O8 | TCM-ID: TCMC5779 |
| Smiles: CCCC(=O)c1c2OC(C)(C)C=Cc2c2c(c1OC(=O)C)c(cc(=O)o2)C(OC(=O)C)CC | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
A | 1 Reference(s) |
| T71GRQ | Hexokinase-2 | HK2 |
P52789 |
A | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0719 | Chen Pi | 陈皮 | Dried tangerine peel | Pericarpium citri reticulatae |
Ckey description of the interaction between compound and target