Compound Description
| ID: C0833 | Common name: Chlorogenic Acid |
| IUPAC: (1R,3S,4S,5S)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid | CAS: CAS:327-97-9 |
| Chembl ID: CHEMBL366760 | Pubchem ID: CID:12310830 |
| Formula: C16H18O9 | TCM-ID: TCMC5921 |
| Smiles: O=C(O[C@H]1C[C@](O)(C[C@@H]([C@@H]1O)O)C(=O)[O-])/C=C/c1ccc(c(c1)O)O | |
| Alias:
Chlorogenic acid;
Cyclohexanecarboxylic acid, 3-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,4,5-trihydroxy-, (1S,3R,4R,5R)-; Cyclohexanecarboxylic acid, 3-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,4,5-trihydroxy-, [1S-(1α,3β,4α,5α)]-; (1S,3R,4R,5R)-3-[[3-(3,4-Dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,4,5-trihydroxycyclohexanecarboxylic acid; 3-(3,4-Dihydroxycinnamoyl)quinic acid; 3-Caffeoylquinic acid; 3-O-(3,4-Dihydroxycinnamoyl)-D-quinic acid; 3-O-Caffeoylquinic acid; 5-Chlorogenic acid; Caffeoylquinic acid; Heriguard; NSC 407296; NSC 70861; SW 85834 |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T91T8I | Glucose-6-phosphatase catalytic subunit 1 | G6PC1 |
P35575 |
A | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T74LFK | Neurogenic locus notch homolog protein 1 | NOTCH1 |
P46531 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T22NX4 | Toll-like receptor 2 | TLR2 |
O60603 |
C | 1 Reference(s) |
| T93R42 | Dipeptidyl peptidase 1 | CTSC |
P53634 |
C | 1 Reference(s) |
| T76AZQ | Histidine decarboxylase | HDC |
P19113 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0908 | Ci Wu Jia | 刺五加 | Manypr ickle acanthopana x | Eleutherococcus senticosus |
Ckey description of the interaction between compound and target