Compound Description
| ID: C0894 | Common name: Schisandrol B |
| IUPAC: (9S,10S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-10-ol | CAS: CAS:58546-54-6 |
| Chembl ID: NA | Pubchem ID: CID:59203477 |
| Formula: C23H28O7 | TCM-ID: TCMC6852 |
| Smiles: COc1cc2C[C@H](C)[C@@](C)(O)Cc3c(c2c(c1OC)OC)c(OC)c1c(c3)OCO1 | |
| Alias:
Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, stereoisomer;
(6S,7S,13aR)-5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol; (+)-Gomisin A; Besigomsin; Gomisin A; Schisandrol B; Schisantherinol B; Schizandrol B; TJN 101; Wuweizi alcohol B; Wuweizichun B |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T19JEU | Beta-galactosidase | GLB1 |
P16278 |
A | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
A | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0605 | Wu Wei Zi | 五味子 | Chinese magnoliavine | Schisandra chinensis |
Ckey description of the interaction between compound and target