Compound Description
| ID: C0941 | Common name: ursodeoxycholic acid |
| IUPAC: (4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | CAS: CAS:128-13-2 |
| Chembl ID: NA | Pubchem ID: CID:388708 |
| Formula: C24H40O4 | TCM-ID: TCMC7385 |
| Smiles: CC(CCC(=O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C | |
| Alias:
5beta-Cholan-24-oic acid, 3alpha,7beta-dihydroxy- (8CI);
5beta-Cholanic acid, 3alpha,7beta-dihydroxy- (7CI); 17beta-(1-Methyl-3-carboxypropyl)etiocholane-3alpha,7beta-diol; 3alpha,7beta-Dihydroxy-5beta-cholan-24-oate; 3alpha,7beta-Dihydroxy-5beta-cholan-24-oic acid; 3alpha,7beta-Dihydroxy-5beta-cholanic acid; 3alpha,7beta-Dihydroxy-5beta-cholanoic acid; 3alpha,7beta-Dihydroxycholanic acid; 7beta-Hydroxylithocholic acid; Actigall; Adursal; Arsacol; Cholit-Ursan; Delursan; Desocol; Desol; Destolit; Deursil; Litursol; Lyeton; NSC 683769; Paptarom; Solutrat; UDCA; Urdes; Ursacol; Urso; Ursobilin; Ursochol; Ursocholic acid, deoxy-; Ursodamor; Ursodeoxycholic acid; Ursodesoxycholic acid; Ursodiol; Ursofalk; Ursolvan |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
B | 1 Reference(s) |
| T35HXI | Gastrotropin | FABP6 |
P51161 |
B | 1 Reference(s) |
| T55EFK | Transcription factor E2F1 | E2F1 |
Q01094 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target