Compound Description
| ID: C0953 | Common name: quinidine |
| IUPAC: (S)-[(4S,5R,7R)-5-ethenyl-1-azabicyclo[2.2.2]octan-7-yl]-(6-methoxyquinolin-4-yl)methanol | CAS: CAS:56-54-2 |
| Chembl ID: CHEMBL1294 | Pubchem ID: CID:441074 |
| Formula: C20H24N2O2 | TCM-ID: TCMC7397 |
| Smiles: COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O | |
| Alias:
Quinidine (8CI);
(+)-Quinidine; (8R,9S)-Quinidine; Chinidin; Cin-quin; Conchinin; Conchinine; Conquinine; Kinidin; Pitayin; Pitayine; Quindine; beta-Quinidine; beta-Quinine |
Structure:
|
Related Targets (Total: 9)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T11ZYR | Cytochrome P450 2D6 | CYP2D6 |
P10635 |
A | 1 Reference(s) |
| T70FR8 | Ileal sodium/bile acid cotransporter | SLC10A2 |
Q12908 |
B | 1 Reference(s) |
| T16A2X | Catalase | CAT |
P04040 |
B | 1 Reference(s) |
| T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
B | 1 Reference(s) |
| T46AQJ | Glutathione S-transferase P | GSTP1 |
P09211 |
B | 1 Reference(s) |
| T87WYU | Glutathione S-transferase Mu 1 | GSTM1 |
P09488 |
B | 1 Reference(s) |
| T02WMA | Ornithine decarboxylase | ODC1 |
P11926 |
B | 1 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
B | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target