Compound Description
| ID: C0958 | Common name: cantharidin |
| IUPAC: NA | CAS: CAS:56-25-7 |
| Chembl ID: CHEMBL48449 | Pubchem ID: CID:5944 |
| Formula: C10H12O4 | TCM-ID: TCMC7401 |
| Smiles: CC12C3CCC(C1(C(=O)OC2=O)C)O3 | |
| Alias:
4,7-Epoxyisobenzofuran-1,3-dione, hexahydro-3a,7a-dimethyl-, (3aalpha,4beta,7beta,7aalpha)-;
7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic anhydride, 2,3-dimethyl- (8CI); Cantharidin (6CI,7CI); 1,2-Dimethyl-3,6-epoxyperhydrophthalic anhydride; Cantharides camphor; Cantharidine; Cantharone; Hexahydro-3a,7a-dimethyl-4,7-epoxyisobenzofuran-1,3-dione; Kantaridin; NSC 61805; exo-1,2-cis-Dimethyl-3,6-epoxyhexahydrophthalic anhydride |
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T33TRT | Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform | PPP2R2A |
P63151 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
B | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T55TEP | Steroidogenic acute regulatory protein, mitochondrial | STAR |
P49675 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target