Compound Description
| ID: C0989 | Common name: hypericin |
| IUPAC: NA | CAS: CAS:548-04-9 |
| Chembl ID: NA | Pubchem ID: CID:5281051 |
| Formula: C30H16O8 | TCM-ID: TCMC7431 |
| Smiles: CC1=CC(=C2C3=C4C5=C(C(=CC(=C5C2=O)O)O)C6=C7C4=C8C(=C13)C(=CC(=C8C(=O)C7=C(C=C6O)O)O)C)O | |
| Alias:
1,3,4,6,8,13-Hexahydroxy-10,11-dimethylphenanthro[1,10,9,8-opqra]perylene-7,14-dione P-conformer;
Cyclo-Werol; Cyclosan; Hypericin; Hypericum red; NSC 407313 |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T23RXU | Glutathione reductase, mitochondrial | GSR |
P00390 |
B | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
B | 1 Reference(s) |
| T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
B | 1 Reference(s) |
| T80OJF | Interstitial collagenase | MMP1 |
P03956 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target