Compound Description
| ID: C0991 | Common name: domoic acid |
| IUPAC: (2S,3S,4S)-3-(carboxymethyl)-4-[(2Z,4E,6R)-7-hydroxy-6-methyl-7-oxohepta-2,4-dien-2-yl]pyrrolidine-2-carboxylic acid | CAS: CAS:14277-97-5 |
| Chembl ID: CHEMBL1232313 | Pubchem ID: CID:5282253 |
| Formula: C15H21NO6 | TCM-ID: TCMC7433 |
| Smiles: CC(C=CC=C(C)C1CNC(C1CC(=O)O)C(=O)O)C(=O)O | |
| Alias:
3-Pyrrolidineacetic acid, 2-carboxy-4-(5-carboxy-1-methyl-1,3-hexadienyl)-, [2S-[2alpha,3beta,4beta(1Z,3E,5S*)]]-;
3-Pyrrolidineacetic acid, 2-carboxy-4-[(1Z,3E,5R)-5-carboxy-1-methyl-1,3-hexadienyl]-, (2S,3S,4S)- (9CI); Domoic acid (6CI,7CI); (-)-Domoic acid; L-Domoic acid; NSC 288031 |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
B | 1 Reference(s) |
| T97KFC | Transcription factor jun-B | JUNB |
P17275 |
B | 1 Reference(s) |
| T71UHA | Transcription factor jun-D | JUND |
P17535 |
B | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 2 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
B | 2 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target