Compound Description
| ID: C0999 | Common name: eriodictyol |
| IUPAC: 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one | CAS: CAS:552-58-9 |
| Chembl ID: CHEMBL307893 | Pubchem ID: CID:11095 |
| Formula: C15H12O6 | TCM-ID: TCMC7441 |
| Smiles: C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O | |
| Alias:
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-, (S)-;
Eriodictyol (6CI); Flavanone, 3',4',5,7-tetrahydroxy- (7CI,8CI); (+)-Eriodictyol; (2S)-Eriodictyol; (S)-3',4',5,7-Tetrahydroxyflavanone; Huazhongilexone |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
B | 1 Reference(s) |
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
B | 1 Reference(s) |
| T38EQ6 | NAD(P)H dehydrogenase [quinone] 1 | NQO1 |
P15559 |
B | 1 Reference(s) |
| T60GGR | Serine/threonine-protein kinase TBK1 | TBK1 |
Q9UHD2 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target