Compound Description
| ID: C1014 | Common name: biotin |
| IUPAC: 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-6-yl)pentanoic acid | CAS: CAS:58-85-5 |
| Chembl ID: CHEMBL1527083 | Pubchem ID: CID:253 |
| Formula: C10H16N2O3S | TCM-ID: TCMC7455 |
| Smiles: C1C2C(C(S1)CCCCC(=O)O)NC(=O)N2 | |
| Alias:
1H-Thieno[3,4-d]imidazole-4-pentanoic acid, hexahydro-2-oxo-, [3aS-(3aalpha,4beta,6aalpha)]-;
Biotin (8CI); (+)-Biotin; (+)-cis-Hexahydro-2-oxo-1H-thieno[3,4]imidazole-4-valeric acid; Biodermatin; Bioepiderm; Bios II; Coenzyme R; D(+)-Biotin; D-Biotin; Factor S; Factor S (vitamin); Lutavit H2; Meribin; NSC 63865; Rovimix H 2; Vitamin B7; Vitamin H; cis-(+)-Tetrahydro-2-oxothieno[3,4]imidazoline-4-valeric acid; d-Biotin |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T71TE9 | Retinal guanylyl cyclase 2 | GUCY2F |
P51841 |
A | 1 Reference(s) |
| T89L4V | Insulin | INS |
P01308 |
B | 2 Reference(s) |
| T82S6C | Hexokinase-4 | GCK |
P35557 |
B | 3 Reference(s) |
| T69XVX | Cytochrome P450 1B1 | CYP1B1 |
Q16678 |
B | 1 Reference(s) |
| T88B8X | Insulin receptor | INSR |
P06213 |
C | 1 Reference(s) |
| T37WY2 | Phosphoenolpyruvate carboxykinase, cytosolic [GTP] | PCK1 |
P35558 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target