Compound Description
| ID: C1022 | Common name: alpha-santalol |
| IUPAC: NA | CAS: CAS:115-71-9 |
| Chembl ID: NA | Pubchem ID: CID:5281531 |
| Formula: C15H24O | TCM-ID: TCMC7462 |
| Smiles: CC(=CCCC1(C2CC3C1(C3C2)C)C)CO | |
| Alias:
2-Penten-1-ol, 5-(2,3-dimethyltricyclo[2.2.1.02,6]hept-3-yl)-2-methyl-, [R(Z)]- (8CI);
2-Penten-1-ol, 5-(2,3-dimethyltricyclo[2.2.1.02,6]hept-3-yl)-2-methyl-, stereoisomer; alpha-Santalol (6CI,7CI); Tricyclo[2.2.1.02,6]heptane, 2-penten-1-ol deriv.; (+)-(Z)-alpha-Santalol; (+)-alpha-Santalol; (Z)-alpha-Santalol; Sandal; Santalol a; cis-alpha-Santalol; d-alpha-Santalol |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
B | 1 Reference(s) |
| T02WMA | Ornithine decarboxylase | ODC1 |
P11926 |
B | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target