Compound Description
| ID: C1029 | Common name: ulinastatin |
| IUPAC: 9-furan-2-yl-8,10-dioxaspiro[5.5]undec-3-ene | CAS: CAS:80449-31-6 |
| Chembl ID: NA | Pubchem ID: CID:105102 |
| Formula: C13H16O3 | TCM-ID: TCMC7469 |
| Smiles: C1CC2(CC=C1)COC(OC2)C3=CC=CO3 | |
| Alias:
Bikunin;
Estotin; Mingin; Miraclid; Trypsin inhibitor UTI; Trypsin inhibitor UTI-1; Trypsin inhibitor, mingin; UTI; Ulinastatin; Urinary trypsin inhibitor; Urinary trypsin inhibitor 1; Urinastatin; Uristatin |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T39YFG | Trypsin-1 | PRSS1 |
P07477 |
A | 1 Reference(s) |
| T41ZO1 | Chymotrypsin-C | CTRC |
Q99895 |
A | 1 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
A | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 2 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target