Compound Description
| ID: C1061 | Common name: hecogenin |
| IUPAC: NA | CAS: CAS:467-55-0 |
| Chembl ID: CHEMBL3185544 | Pubchem ID: CID:91453 |
| Formula: C27H42O4 | TCM-ID: TCMC7499 |
| Smiles: CC1CCC2(C(C3C(O2)CC4C3(C(=O)CC5C4CCC6C5(CCC(C6)O)C)C)C)OC1 | |
| Alias:
5alpha,25D-Spirostan-12-one, 3beta-hydroxy- (7CI);
5alpha-Spirostan-12-one, 3beta-hydroxy-, (25R)- (8CI); (+)-Hecogenin; (25R)-3beta-Hydroxy-5alpha-spirostan-12-one; (3beta,5alpha,25R)-3-Hydroxyspirostan-12-one; 12-Oxotigogenin; Gekogenin; Hecogenin; Hekogenin; Hocogenin; NSC 115921 |
Structure:
|
Related Targets (Total: 2)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T13PKY | Activator of 90 kDa heat shock protein ATPase homolog 1 | AHSA1 |
O95433 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target