Compound Description
| ID: C1094 | Common name: costunolide |
| IUPAC: (3aS,6Z,10E,11aR)-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one | CAS: CAS:553-21-9 |
| Chembl ID: NA | Pubchem ID: CID:5380858 |
| Formula: C15H20O2 | TCM-ID: TCMC7531 |
| Smiles: CC1=CCCC(=CC2C(CC1)C(=C)C(=O)O2)C | |
| Alias:
Costunolide (6CI);
Cyclodeca[b]furan-2(3H)-one, 3a,4,5,8,9,11a-hexahydro-6,10-dimethyl-3-methylene-, [3aS-(3aR*,6E,10E,11aS*)]-; Germacra-1(10),4,11(13)-trien-12-oic acid, 6alpha-hydroxy-, gamma-lactone, (E,E)- (8CI); (+)-Costunolide; Costunolid; Costus lactone; NSC 106404 |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T83M25 | Beta-hexosaminidase subunit alpha | HEXA |
P06865 |
A | 1 Reference(s) |
| T78IOY | Telomerase reverse transcriptase | TERT |
O14746 |
A | 1 Reference(s) |
| T64T4I | Telomerase protein component 1 | TEP1 |
Q99973 |
B | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
B | 1 Reference(s) |
| T26KIE | Transcription factor AP-1 | JUN |
P05412 |
C | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target