Compound Description
| ID: C1097 | Common name: lignin |
| IUPAC: (2R)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfopropyl)phenoxy]propane-1-sulfonic acid | CAS: CAS:9005-53-2 |
| Chembl ID: NA | Pubchem ID: CID:25113471 |
| Formula: NA | TCM-ID: TCMC7534 |
| Smiles: COC1=CC=CC(=C1O)CC(CS(=O)(=O)O)OC2=C(C=C(C=C2)CCCS(=O)(=O)O)OC | |
| Alias:
APPL;
Acid-precipitable polymeric lignin; Ball-milled lignin; Biolignin; Cellulase lignin; DHP lignin; Methyllignin; Native lignin; Pepper lignin; Protobind 100SA140; Protolignin; Reax 31; Sarkanda |
Structure:
|
Related Targets (Total: 2)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T99W15 | Pancreatic triacylglycerol lipase | PNLIP |
P16233 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target