Compound Description
| ID: C1112 | Common name: proscillaridin a |
| IUPAC: 5-[(3S,8R,9S,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pyran-2-one | CAS: CAS:466-06-8 |
| Chembl ID: CHEMBL1977418 | Pubchem ID: CID:222154 |
| Formula: C30H42O8 | TCM-ID: TCMC7548 |
| Smiles: CC1C(C(C(C(O1)OC2CCC3(C4CCC5(C(CCC5(C4CCC3=C2)O)C6=COC(=O)C=C6)C)C)O)O)O | |
| Alias:
Proscillaridin A (6CI,7CI,8CI);
14-Hydroxy-3beta-(rhamnosyloxy)bufa-4,20,22-trienolide; 3beta-Rhamnosido-14beta-hydroxy-4,20,22-bufatrienolide; 3beta-[(6-Deoxy-alpha-L-mannopyranosyl)oxy]-14-hydroxybufa-4,20,22-trienolide; A 32686; Caradrin; Cardion; Cardiovite; Carmazon; Coratol; Desglucotransvaaline; Desglucotrnasvaaline; Herzo Proscillan; NSC 7521; PSC-801; Procardin; Procilan; Proscillan; Proscillaridin; Prostosin; Proszine; Protasin; Purosin-TC; Sandoscill; Scillacrist; Scillarenin 3beta-rhamnoside; Simeon; Solestril; Stellarid; Talucard; Talusin; Tradenal; Transvaalin, degluco-; Urgilan; Wirnesin |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T51IKV | DNA topoisomerase 2-alpha | TOP2A |
P11388 |
A | 1 Reference(s) |
| T99XQ3 | DNA topoisomerase 1 | TOP1 |
P11387 |
B | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target