Compound Description
| ID: C1129 | Common name: panaxydol |
| IUPAC: (3R)-8-[(2R,3S)-3-heptyloxiran-2-yl]oct-1-en-4,6-diyn-3-ol | CAS: CAS:72800-72-7 |
| Chembl ID: NA | Pubchem ID: CID:126312 |
| Formula: C17H24O2 | TCM-ID: TCMC7563 |
| Smiles: CCCCCCCC1C(O1)CC#CC#CC(C=C)O | |
| Alias:
1-Octene-4,6-diyn-3-ol, 8-(3-heptyloxiranyl)-, [2R-[2alpha(R*),3alpha]]-;
1-Octene-4,6-diyn-3-ol, 8-[(2R,3S)-3-heptyloxiranyl]-, (3R)- (9CI); (-)-Panaxydol; Panaxydol |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T75H3W | Cyclin-dependent kinase 2 | CDK2 |
P24941 |
B | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
C | 1 Reference(s) |
| T83QHM | Beta-nerve growth factor | NGF |
P01138 |
C | 1 Reference(s) |
| T01D27 | Eukaryotic translation initiation factor 6 | EIF6 |
P56537 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target