Compound Description
| ID: C1204 | Common name: Caffeic Acid Phenethyl Ester |
| IUPAC: 2-phenylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate | CAS: CAS:104594-70-9 |
| Chembl ID: CHEMBL319244 | Pubchem ID: CID:5281787 |
| Formula: C17H16O4 | TCM-ID: TCMC849 |
| Smiles: O=C(/C=C/c1ccc(c(c1)O)O)OCCc1ccccc1 | |
| Alias:
2-Phenylethyl caffeate;
CAPE; Caffeic acid phenethyl ester; β-Phenylethyl caffeate |
Structure:
|
Related Targets (Total: 13)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 11 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
A | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 2 Reference(s) |
| T56TXY | Polyunsaturated fatty acid 5-lipoxygenase | ALOX5 |
P09917 |
A | 1 Reference(s) |
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
A | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
A | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
A | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 1 Reference(s) |
| T66WWM | Claudin-2 | CLDN2 |
P57739 |
C | 1 Reference(s) |
| T22N8Q | Rho-related GTP-binding protein RhoB | RHOB |
P62745 |
C | 1 Reference(s) |
| T37VLU | Interferon gamma | IFNG |
P01579 |
C | 1 Reference(s) |
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
C | 1 Reference(s) |
| T76B0A | Gap junction alpha-1 protein | GJA1 |
P17302 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target