| ID: C1216 | Common name: Cardamomin |
| IUPAC: (E)-1-(2,4-dihydroxy-6-methoxyphenyl)-3-phenylprop-2-en-1-one | CAS: CAS:19309-14-9 |
| Chembl ID: CHEMBL378104 | Pubchem ID: CID:641785 |
| Formula: C16H14O4 | TCM-ID: TCMC870 |
| Smiles: COC1=CC(=CC(=C1C(=O)C=CC2=CC=CC=C2)O)O | |
| Alias:
2-Propen-1-one, 1-(2,4-dihydroxy-6-methoxyphenyl)-3-phenyl-, (E)-;
Chalcone, 2',4'-dihydroxy-6'-methoxy-; (2E)-1-(2,4-Dihydroxy-6-methoxyphenyl)-3-phenyl-2-propen-1-one; Alpinetin chalcone; Cardamomin; Cardamonin |
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 2 Reference(s) |
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
A | 1 Reference(s) |
| T92BZ2 | Catenin beta-1 | CTNNB1 |
P35222 |
A | 1 Reference(s) |
| T09INZ | Transient receptor potential cation channel subfamily A member 1 | TRPA1 |
O75762 |
A | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
C | 1 Reference(s) |