| ID: C1263 | Common name: Cryptotanshinone |
| IUPAC: (1R)-1,6,6-trimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione | CAS: CAS:35825-57-1 |
| Chembl ID: CHEMBL187460 | Pubchem ID: CID:160254 |
| Formula: C19H20O3 | TCM-ID: TCMC957 |
| Smiles: C[C@H]1COC2=C1C(=O)C(=O)c1c2ccc2c1CCCC2(C)C | |
| Alias:
Phenanthro[1,2-b]furan-10,11-dione, 1,2,6,7,8,9-hexahydro-1,6,6-trimethyl-, (R)-;
(1R)-1,2,6,7,8,9-Hexahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione; (15R)-Cryptotanshinone; (1R)-1,6,6-Trimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione; Cryototanshinone; Cryptotanshinon; Cryptotanshinone; Tanshinone c |
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 3 Reference(s) |
| T75HMM | Induced myeloid leukemia cell differentiation protein Mcl-1 | MCL1 |
Q07820 |
A | 1 Reference(s) |
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
A | 1 Reference(s) |
| T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
C | 1 Reference(s) |
| T73LPO | Poly [ADP-ribose] polymerase 1 | PARP1 |
P09874 |
C | 1 Reference(s) |
| T90ADC | BH3-interacting domain death agonist | BID |
P55957 |
C | 1 Reference(s) |