Compound Description
| ID: C0020 | Common name: Digoxin |
| IUPAC: 3-[(3S,5R,8R,9S,10S,12R,13S,14S,17R)-3-[(2R,4S,5S,6R)-5-[(2S,4S,5S,6R)-5-[(2S,4S,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-12,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one | CAS: CAS:20830-75-5 |
| Chembl ID: CHEMBL1751 | Pubchem ID: CID:2724385 |
| Formula: C41H64O14 | TCM-ID: TCMC1043 |
| Smiles: O=C1OCC(=C1)[C@H]1CC[C@]2([C@]1(C)[C@H](O)C[C@H]1[C@H]2CC[C@H]2[C@]1(C)CC[C@@H](C2)O[C@H]1C[C@H](O)[C@@H]([C@H](O1)C)O[C@H]1C[C@H](O)[C@@H]([C@H](O1)C)O[C@H]1C[C@H](O)[C@@H]([C@H](O1)C)O)O | |
| Alias:
Digitoxin, 12β-hydroxy-;
Digoxin; (3β,5β,12β)-3-[(O-2,6-Dideoxy-β-D-ribo-hexopyranosyl-(1→4)-O-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl)oxy]-12,14-dihydroxycard-20(22)-enolide; 12β-Hydroxydigitoxin; Cardigox; Cardiogoxin; Cardioxin; Cardixin; Cardoxin; Chloroformic digitalin; Coragoxine; Cordioxil; Davoxin; Digacin; Digicor; Digitek; Digomal; Digon; Digosin; Digoxin Nativelle; Digoxine; Dilanacin; Dixina; Dokim; Dynamos; Eudigox; Fargoxin; Grexin; Homolle's digitalin; Lanacordin; Lanacrist; Lanicor; Lanikor; Lanocardin; Lanorale; Lanoxicaps; Lanoxin; Lanoxin PG; Lenoxicaps; Lenoxin; Longdigox; Mapluxin; NSC 95100; Natigoxin; NeoDioxanin; Novodigal-Amp.; Purgoxin; Rougoxin; Stillacor; Toloxin; Vanoxin |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
A | 6 Reference(s) |
| T99V1T | Dynein heavy chain 8, axonemal | DNAH8 |
Q96JB1 |
A | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 1 Reference(s) |
| T45G32 | Proto-oncogene tyrosine-protein kinase Src | SRC |
P12931 |
A | 1 Reference(s) |
| T85NRC | Pyruvate kinase PKM | PKM |
P14618 |
B | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target