Compound Description
| ID: C0056 | Common name: Estriol |
| IUPAC: (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol | CAS: CAS:50-27-1 |
| Chembl ID: CHEMBL193482 | Pubchem ID: CID:5756 |
| Formula: C18H24O3 | TCM-ID: TCMC1135 |
| Smiles: CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O | |
| Alias:
Estriol;
(16α,17β)-Estra-1,3,5(10)-triene-3,16,17-triol; 13β-Methyl-1,3,5(10)-gonatriene-3,16α,17β-triol; 16α,17β-Estriol; 16α-Estriol; 16α-Hydroxyestradiol; 3,16α,17β-Estriol; 3,16α,17β-Trihydroxyestra-1,3,5(10)-triene; Aacifemine; Colpogyn; Destriol; Estra-1,3,5(10)-triene-3,16α,17β-triol; Estratriol; Estriel; Follicular hormone hydrate; Gynasan; Holin V; Hormomed; Incurin; Klimax E; Klimoral; NSC 12169; OE3; Oekolp; Oestriol; Ortho-Gynest; Ovesterin; Ovestin; Ovestrion; Ovo-Vinces; Theelol; Tridestrin; Trihydroxyestrin; Triovex |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T32YAJ | G-protein coupled estrogen receptor 1 | GPER1 |
Q99527 |
A | 1 Reference(s) |
| T49PL1 | Low-density lipoprotein receptor | LDLR |
P01130 |
B | 1 Reference(s) |
| T65UYH | Syndecan-3 | SDC3 |
O75056 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target