Compound Description
| ID: C0085 | Common name: Fraxetin |
| IUPAC: 7,8-dihydroxy-6-methoxychromen-2-one | CAS: CAS:574-84-5 |
| Chembl ID: CHEMBL54909 | Pubchem ID: CID:5273569 |
| Formula: C10H8O5 | TCM-ID: TCMC1188 |
| Smiles: COC1=C(C(=C2C(=C1)C=CC(=O)O2)O)O | |
| Alias:
Coumarin, 7,8-dihydroxy-6-methoxy-;
Fraxetin; 7,8-Dihydroxy-6-methoxy-2H-1-benzopyran-2-one; 6-Methoxy-7,8-dihydroxycoumarin; 7,8-Dihydroxy-6-methoxycoumarin; Fratexin; Fraxetol |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 1 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T31SX8 | Bone morphogenetic protein 2 | BMP2 |
P12643 |
B | 1 Reference(s) |
| T19BO9 | Bone morphogenetic protein 4 | BMP4 |
P12644 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target