Compound Description
| ID: C0098 | Common name: Gdp |
| IUPAC: [(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate | CAS: CAS:146-91-8 |
| Chembl ID: CHEMBL384759 | Pubchem ID: CID:8977 |
| Formula: C10H15N5O11P2 | TCM-ID: TCMC1233 |
| Smiles: O[C@@H]1[C@@H](COP(=O)(OP(=O)(O)O)O)O[C@H]([C@@H]1O)n1cnc2c1[nH]c(=N)nc2O | |
| Alias:
Guanosine 5'-(trihydrogen pyrophosphate);
Guanosine pyrophosphate; 5'-GDP; GDP; Guanosine 5'-diphosphate; Guanosine 5'-pyrophosphate; Guanosine diphosphate; Guanosine, mono(trihydrogen diphosphate) (ester) |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T67RBZ | Mitochondrial uncoupling protein 2 | UCP2 |
P55851 |
A | 1 Reference(s) |
| T08U92 | Mitochondrial brown fat uncoupling protein 1 | UCP1 |
P25874 |
A | 5 Reference(s) |
| T67HYX | Mitochondrial uncoupling protein 3 | UCP3 |
P55916 |
A | 1 Reference(s) |
| T47GM7 | Cytoplasmic dynein 1 light intermediate chain 1 | DYNC1LI1 |
Q9Y6G9 |
B | 1 Reference(s) |
| T85SK7 | Eukaryotic translation initiation factor 5B | EIF5B |
O60841 |
B | 1 Reference(s) |
| T92ZDN | GTPase KRas | KRAS |
P01116 |
B | 1 Reference(s) |
| T28CFG | Synphilin-1 | SNCAIP |
Q9Y6H5 |
B | 1 Reference(s) |
| T08UG7 | Ras-related protein Ral-A | RALA |
P11233 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target