ID: C0201 | Common name: Lycorine |
IUPAC: NA | CAS: CAS:476-28-8 |
Chembl ID: CHEMBL400092 | Pubchem ID: CID:72378 |
Formula: C16H17NO4 | TCM-ID: TCMC1518 |
Smiles: C1CN2CC3=CC4=C(C=C3C5C2C1=CC(C5O)O)OCO4 | |
Alias:
Galanthan-1,2-diol, 3,12-didehydro-9,10-[methylenebis(oxy)]-, (1α,2β)-;
Galanthidine; Lycoran-1α,2β-diol, 3,3a-didehydro-; (1S,2S,12bS,12cS)-2,4,5,7,12b,12c-Hexahydro-1H-[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridine-1,2-diol; (-)-Lycorine; 1H-[1,3]Dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridine-1,2-diol, 2,4,5,7,12b,12c-hexahydro-, [1S-(1α,2β,12bβ,12cα)]-; 3,3a-Didehydrolycoran-1α,2β-diol; 3,4-Didehydro-11,12-[methylenebis(oxy)]galanthan-1α,2β-diol; Amarylline; Lycorine; NSC 401360; NSC 683873; Narcissin; Narcissine |
Structure:
![]() |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 1 Reference(s) |
T38T1U | Caspase-8 | CASP8 |
Q14790 |
B | 1 Reference(s) |
T10S5F | Cyclin-dependent kinase 4 | CDK4 |
P11802 |
B | 1 Reference(s) |
T23P74 | Caspase-9 | CASP9 |
P55211 |
B | 1 Reference(s) |
T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 2 Reference(s) |
T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
B | 2 Reference(s) |