Compound Description
| ID: C0272 | Common name: Ouabain |
| IUPAC: 3-[(1R,3S,5S,8R,9S,10R,11R,13R,14S,17R)-1,5,11,14-tetrahydroxy-10-(hydroxymethyl)-13-methyl-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one | CAS: CAS:630-60-4 |
| Chembl ID: CHEMBL222863 | Pubchem ID: CID:439501 |
| Formula: C29H44O12 | TCM-ID: TCMC1804 |
| Smiles: OC[C@@]12[C@H](O)C[C@@H](C[C@@]2(O)CC[C@@H]2[C@@H]1[C@H](O)C[C@]1([C@]2(O)CC[C@@H]1C1=CC(=O)OC1)C)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O | |
| Alias:
Ouabain;
(1β,3β,5β,11α)-3-[(6-Deoxy-α-L-mannopyranosyl)oxy]-1,5,11,14,19-pentahydroxycard-20(22)-enolide; Acocantherin; Astrobain; Gratibain; Gratus strophanthin; Kombetin; NSC 25485; Ouabaine; Purostrophan; Rectobaina; Solufantina; Strodival; Strophalen; Strophoperm; Strophosan; Uabaina; Uabanin; g-Strophanthin; g-Strophicor |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T70OGQ | Sodium/potassium-transporting ATPase subunit alpha-1 | ATP1A1 |
P05023 |
A | 1 Reference(s) |
| T27BN7 | Protachykinin-1 | TAC1 |
P20366 |
A | 3 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 2 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
C | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 1 Reference(s) |
| T37SV3 | Occludin | OCLN |
Q16625 |
C | 1 Reference(s) |
| T94S85 | Collagen alpha-1(I) chain | COL1A1 |
P02452 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0232 | Mao He Zi | 毛诃子 | friot of belleric terminalia | Fructus terminaliae billericae |
Ckey description of the interaction between compound and target