Compound Description
| ID: C0484 | Common name: Wedelolactone |
| IUPAC: 1,8,9-trihydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one | CAS: CAS:524-12-9 |
| Chembl ID: CHEMBL97453 | Pubchem ID: CID:5281813 |
| Formula: C16H10O7 | TCM-ID: TCMC2235 |
| Smiles: COC1=CC(=C2C(=C1)OC(=O)C3=C2OC4=CC(=C(C=C43)O)O)O | |
| Alias:
1,8,9-Trihydroxy-3-methoxy-6H-benzofuro[3,2-c][1]benzopyran-6-one;
1,8,9-Trihydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one; Wedelolactone |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T20JZ2 | Androgen receptor | AR |
P10275 |
A | 1 Reference(s) |
| T05RAA | Inhibitor of nuclear factor kappa-B kinase subunit alpha | CHUK |
O15111 |
A | 1 Reference(s) |
| T83P5X | Inhibitor of nuclear factor kappa-B kinase subunit beta | IKBKB |
O14920 |
A | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 3 Reference(s) |
| T56TXY | Polyunsaturated fatty acid 5-lipoxygenase | ALOX5 |
P09917 |
A | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target